C44H48N2+2 — CID 123820149
10-butyl-3,6,7-triethyl-6-methyl-7-[(3-phenylbenzo[a]quinolizin-5-ium-7-yl)methyl]benzo[a]quinolizin-5-ium (PubChem CID 123820149) has the molecular formula C44H48N2+2 and a molecular weight of 604.88 g/mol. Its IUPAC name is 10-butyl-3,6,7-triethyl-6-methyl-7-[(3-phenylbenzo[a]quinolizin-5-ium-7-yl)methyl]benzo[a]quinolizin-5-ium.
| Compound Name | 10-butyl-3,6,7-triethyl-6-methyl-7-[(3-phenylbenzo[a]quinolizin-5-ium-7-yl)methyl]benzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123820149 |
| Molecular Formula | C44H48N2+2 |
| Molecular Weight | 604.88 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | 10-butyl-3,6,7-triethyl-6-methyl-7-[(3-phenylbenzo[a]quinolizin-5-ium-7-yl)methyl]benzo[a]quinolizin-5-ium |
| SMILES | CCCCc1ccc2c(c1)-c1ccc(CC)c[n+]1C(C)(CC)C2(CC)Cc1c[n+]2cc(-c3ccccc3)ccc2c2ccccc12 |
| InChI | InChI=1S/C44H48N2/c1-6-10-16-33-21-24-40-39(27-33)42-25-22-32(7-2)29-46(42)43(5,8-3)44(40,9-4)28-36-31-45-30-35(34-17-12-11-13-18-34)23-26-41(45)38-20-15-14-19-37(36)38/h11-15,17-27,29-31H,6-10,16,28H2,1-5H3/q+2 |
| InChIKey | TUCWYLCHQZYIDG-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 7.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.88 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|