C44H52N2+2 — CID 91322756
3-(2-butylphenyl)-7-[2-[2-(1,5-dimethylpyridin-1-ium-2-yl)phenyl]ethyl]-6,7-diethyl-2,6-dimethylbenzo[a]quinolizin-5-ium (PubChem CID 91322756) has the molecular formula C44H52N2+2 and a molecular weight of 608.91 g/mol. Its IUPAC name is 3-(2-butylphenyl)-7-[2-[2-(1,5-dimethylpyridin-1-ium-2-yl)phenyl]ethyl]-6,7-diethyl-2,6-dimethylbenzo[a]quinolizin-5-ium.
| Compound Name | 3-(2-butylphenyl)-7-[2-[2-(1,5-dimethylpyridin-1-ium-2-yl)phenyl]ethyl]-6,7-diethyl-2,6-dimethylbenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 91322756 |
| Molecular Formula | C44H52N2+2 |
| Molecular Weight | 608.91 g/mol |
| Exact Mass | 608.41 |
| IUPAC Name | 3-(2-butylphenyl)-7-[2-[2-(1,5-dimethylpyridin-1-ium-2-yl)phenyl]ethyl]-6,7-diethyl-2,6-dimethylbenzo[a]quinolizin-5-ium |
| SMILES | CCCCc1ccccc1-c1c[n+]2c(cc1C)-c1ccccc1C(CC)(CCc1ccccc1-c1ccc(C)c[n+]1C)C2(C)CC |
| InChI | InChI=1S/C44H52N2/c1-8-11-18-34-19-12-14-21-36(34)39-31-46-42(29-33(39)5)38-23-16-17-24-40(38)44(10-3,43(46,6)9-2)28-27-35-20-13-15-22-37(35)41-26-25-32(4)30-45(41)7/h12-17,19-26,29-31H,8-11,18,27-28H2,1-7H3/q+2 |
| InChIKey | HCIVEPPYEHFHDX-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.91 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|