C32H45N2+ — CID 123640213
2-(4-butyl-2,6-dimethylphenyl)-5,6-diethyl-1,5-dimethyl-6-propylimidazo[2,1-a]isoquinolin-4-ium (PubChem CID 123640213) has the molecular formula C32H45N2+ and a molecular weight of 457.73 g/mol. Its IUPAC name is 2-(4-butyl-2,6-dimethylphenyl)-5,6-diethyl-1,5-dimethyl-6-propylimidazo[2,1-a]isoquinolin-4-ium.
| Compound Name | 2-(4-butyl-2,6-dimethylphenyl)-5,6-diethyl-1,5-dimethyl-6-propylimidazo[2,1-a]isoquinolin-4-ium |
|---|---|
| PubChem CID | 123640213 |
| Molecular Formula | C32H45N2+ |
| Molecular Weight | 457.73 g/mol |
| Exact Mass | 457.36 |
| IUPAC Name | 2-(4-butyl-2,6-dimethylphenyl)-5,6-diethyl-1,5-dimethyl-6-propylimidazo[2,1-a]isoquinolin-4-ium |
| SMILES | CCCCc1cc(C)c(-c2c[n+]3c(n2C)-c2ccccc2C(CC)(CCC)C3(C)CC)c(C)c1 |
| InChI | InChI=1S/C32H45N2/c1-9-13-16-25-20-23(5)29(24(6)21-25)28-22-34-30(33(28)8)26-17-14-15-18-27(26)32(12-4,19-10-2)31(34,7)11-3/h14-15,17-18,20-22H,9-13,16,19H2,1-8H3/q+1 |
| InChIKey | LWYUTGMPHHQAKS-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.73 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|