C41H53N2O+ — CID 123956917
1-[7-butyl-1,3-bis(2-methylpropyl)dibenzofuran-4-yl]-5,6-diethyl-5,6-dimethylimidazo[2,1-a]isoquinolin-4-ium (PubChem CID 123956917) has the molecular formula C41H53N2O+ and a molecular weight of 589.89 g/mol. Its IUPAC name is 1-[7-butyl-1,3-bis(2-methylpropyl)dibenzofuran-4-yl]-5,6-diethyl-5,6-dimethylimidazo[2,1-a]isoquinolin-4-ium.
| Compound Name | 1-[7-butyl-1,3-bis(2-methylpropyl)dibenzofuran-4-yl]-5,6-diethyl-5,6-dimethylimidazo[2,1-a]isoquinolin-4-ium |
|---|---|
| PubChem CID | 123956917 |
| Molecular Formula | C41H53N2O+ |
| Molecular Weight | 589.89 g/mol |
| Exact Mass | 589.42 |
| IUPAC Name | 1-[7-butyl-1,3-bis(2-methylpropyl)dibenzofuran-4-yl]-5,6-diethyl-5,6-dimethylimidazo[2,1-a]isoquinolin-4-ium |
| SMILES | CCCCc1ccc2c(c1)oc1c(-n3cc[n+]4c3-c3ccccc3C(C)(CC)C4(C)CC)c(CC(C)C)cc(CC(C)C)c12 |
| InChI | InChI=1S/C41H53N2O/c1-10-13-16-29-19-20-33-35(25-29)44-38-36(33)30(23-27(4)5)26-31(24-28(6)7)37(38)42-21-22-43-39(42)32-17-14-15-18-34(32)40(8,11-2)41(43,9)12-3/h14-15,17-22,25-28H,10-13,16,23-24H2,1-9H3/q+1 |
| InChIKey | SWLMUUHVRKZMIK-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.89 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|