C33H42N+ — CID 123855583
9-butyl-15,16-diethyl-15,16-dimethyl-14-azoniahexacyclo[18.2.2.02,19.04,17.05,14.06,11]tetracosa-2(19),3,5(14),6(11),7,9,12,17-octaene (PubChem CID 123855583) has the molecular formula C33H42N+ and a molecular weight of 452.71 g/mol. Its IUPAC name is 9-butyl-15,16-diethyl-15,16-dimethyl-14-azoniahexacyclo[18.2.2.02,19.04,17.05,14.06,11]tetracosa-2(19),3,5(14),6(11),7,9,12,17-octaene.
| Compound Name | 9-butyl-15,16-diethyl-15,16-dimethyl-14-azoniahexacyclo[18.2.2.02,19.04,17.05,14.06,11]tetracosa-2(19),3,5(14),6(11),7,9,12,17-octaene |
|---|---|
| PubChem CID | 123855583 |
| Molecular Formula | C33H42N+ |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | 9-butyl-15,16-diethyl-15,16-dimethyl-14-azoniahexacyclo[18.2.2.02,19.04,17.05,14.06,11]tetracosa-2(19),3,5(14),6(11),7,9,12,17-octaene |
| SMILES | CCCCc1ccc2c3[n+](ccc2c1)C(C)(CC)C(C)(CC)c1cc2c(cc1-3)C1CCC2CC1 |
| InChI | InChI=1S/C33H42N/c1-6-9-10-22-11-16-26-25(19-22)17-18-34-31(26)29-20-27-23-12-14-24(15-13-23)28(27)21-30(29)32(4,7-2)33(34,5)8-3/h11,16-21,23-24H,6-10,12-15H2,1-5H3/q+1 |
| InChIKey | YRMCAGBISXKQBH-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|