C31H35BrN+ — CID 123745859
7-bromo-11,12-diethyl-11,12-dimethyl-8-phenyl-13-azoniapentacyclo[14.2.2.02,15.04,13.05,10]icosa-2,4(13),5(10),6,8,14-hexaene (PubChem CID 123745859) has the molecular formula C31H35BrN+ and a molecular weight of 501.53 g/mol. Its IUPAC name is 7-bromo-11,12-diethyl-11,12-dimethyl-8-phenyl-13-azoniapentacyclo[14.2.2.02,15.04,13.05,10]icosa-2,4(13),5(10),6,8,14-hexaene.
| Compound Name | 7-bromo-11,12-diethyl-11,12-dimethyl-8-phenyl-13-azoniapentacyclo[14.2.2.02,15.04,13.05,10]icosa-2,4(13),5(10),6,8,14-hexaene |
|---|---|
| PubChem CID | 123745859 |
| Molecular Formula | C31H35BrN+ |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 7-bromo-11,12-diethyl-11,12-dimethyl-8-phenyl-13-azoniapentacyclo[14.2.2.02,15.04,13.05,10]icosa-2,4(13),5(10),6,8,14-hexaene |
| SMILES | CCC1(C)c2cc(-c3ccccc3)c(Br)cc2-c2cc3c(c[n+]2C1(C)CC)C1CCC3CC1 |
| InChI | InChI=1S/C31H35BrN/c1-5-30(3)27-16-24(20-10-8-7-9-11-20)28(32)17-25(27)29-18-23-21-12-14-22(15-13-21)26(23)19-33(29)31(30,4)6-2/h7-11,16-19,21-22H,5-6,12-15H2,1-4H3/q+1 |
| InChIKey | MCBQOZJXVDGFAF-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|