C49H58N2+2 — CID 123354635
2-butyl-6,7-diethyl-1,7-dimethyl-6-[3-[5-(2-methyl-4-phenylphenyl)-4-azoniatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-yl]propyl]benzo[a]quinolizin-5-ium (PubChem CID 123354635) has the molecular formula C49H58N2+2 and a molecular weight of 675.02 g/mol. Its IUPAC name is 2-butyl-6,7-diethyl-1,7-dimethyl-6-[3-[5-(2-methyl-4-phenylphenyl)-4-azoniatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-yl]propyl]benzo[a]quinolizin-5-ium.
| Compound Name | 2-butyl-6,7-diethyl-1,7-dimethyl-6-[3-[5-(2-methyl-4-phenylphenyl)-4-azoniatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-yl]propyl]benzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123354635 |
| Molecular Formula | C49H58N2+2 |
| Molecular Weight | 675.02 g/mol |
| Exact Mass | 674.46 |
| IUPAC Name | 2-butyl-6,7-diethyl-1,7-dimethyl-6-[3-[5-(2-methyl-4-phenylphenyl)-4-azoniatricyclo[6.2.1.02,7]undeca-2,4,6-trien-4-yl]propyl]benzo[a]quinolizin-5-ium |
| SMILES | CCCCc1cc[n+]2c(c1C)-c1ccccc1C(C)(CC)C2(CC)CCC[n+]1cc2c(cc1-c1ccc(-c3ccccc3)cc1C)C1CCC2C1 |
| InChI | InChI=1S/C49H58N2/c1-7-10-17-36-26-29-51-47(35(36)5)42-20-14-15-21-45(42)48(6,8-2)49(51,9-3)27-16-28-50-33-44-40-23-22-39(31-40)43(44)32-46(50)41-25-24-38(30-34(41)4)37-18-12-11-13-19-37/h11-15,18-21,24-26,29-30,32-33,39-40H,7-10,16-17,22-23,27-28,31H2,1-6H3/q+2 |
| InChIKey | POVXONICQDCSES-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.02 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|