C30H34N+ — CID 123357911
11,12-diethyl-11,12-dimethyl-7-phenyl-13-azoniapentacyclo[14.2.1.02,15.04,13.05,10]nonadeca-2,4(13),5(10),6,8,14-hexaene (PubChem CID 123357911) has the molecular formula C30H34N+ and a molecular weight of 408.61 g/mol. Its IUPAC name is 11,12-diethyl-11,12-dimethyl-7-phenyl-13-azoniapentacyclo[14.2.1.02,15.04,13.05,10]nonadeca-2,4(13),5(10),6,8,14-hexaene.
| Compound Name | 11,12-diethyl-11,12-dimethyl-7-phenyl-13-azoniapentacyclo[14.2.1.02,15.04,13.05,10]nonadeca-2,4(13),5(10),6,8,14-hexaene |
|---|---|
| PubChem CID | 123357911 |
| Molecular Formula | C30H34N+ |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | 11,12-diethyl-11,12-dimethyl-7-phenyl-13-azoniapentacyclo[14.2.1.02,15.04,13.05,10]nonadeca-2,4(13),5(10),6,8,14-hexaene |
| SMILES | CCC1(C)c2ccc(-c3ccccc3)cc2-c2cc3c(c[n+]2C1(C)CC)C1CCC3C1 |
| InChI | InChI=1S/C30H34N/c1-5-29(3)27-15-14-21(20-10-8-7-9-11-20)17-25(27)28-18-24-22-12-13-23(16-22)26(24)19-31(28)30(29,4)6-2/h7-11,14-15,17-19,22-23H,5-6,12-13,16H2,1-4H3/q+1 |
| InChIKey | YAIMEJIQAJNWLK-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|