C45H44N+ — CID 123975519
10-[3-[3-(4-butylphenyl)-5-phenylphenyl]phenyl]-7,7-diethyl-6H-benzo[a]quinolizin-5-ium (PubChem CID 123975519) has the molecular formula C45H44N+ and a molecular weight of 598.85 g/mol. Its IUPAC name is 10-[3-[3-(4-butylphenyl)-5-phenylphenyl]phenyl]-7,7-diethyl-6H-benzo[a]quinolizin-5-ium.
| Compound Name | 10-[3-[3-(4-butylphenyl)-5-phenylphenyl]phenyl]-7,7-diethyl-6H-benzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123975519 |
| Molecular Formula | C45H44N+ |
| Molecular Weight | 598.85 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | 10-[3-[3-(4-butylphenyl)-5-phenylphenyl]phenyl]-7,7-diethyl-6H-benzo[a]quinolizin-5-ium |
| SMILES | CCCCc1ccc(-c2cc(-c3ccccc3)cc(-c3cccc(-c4ccc5c(c4)-c4cccc[n+]4CC5(CC)CC)c3)c2)cc1 |
| InChI | InChI=1S/C45H44N/c1-4-7-14-33-20-22-35(23-21-33)40-28-39(34-15-9-8-10-16-34)29-41(30-40)37-18-13-17-36(27-37)38-24-25-43-42(31-38)44-19-11-12-26-46(44)32-45(43,5-2)6-3/h8-13,15-31H,4-7,14,32H2,1-3H3/q+1 |
| InChIKey | CXNXYQVFZSDFQO-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.85 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|