C61H44N+ — CID 123198158
10-[3-[3,5-bis(3,5-diphenylphenyl)phenyl]phenyl]-6,7-dihydrobenzo[a]quinolizin-5-ium (PubChem CID 123198158) has the molecular formula C61H44N+ and a molecular weight of 791.03 g/mol. Its IUPAC name is 10-[3-[3,5-bis(3,5-diphenylphenyl)phenyl]phenyl]-6,7-dihydrobenzo[a]quinolizin-5-ium.
| Compound Name | 10-[3-[3,5-bis(3,5-diphenylphenyl)phenyl]phenyl]-6,7-dihydrobenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123198158 |
| Molecular Formula | C61H44N+ |
| Molecular Weight | 791.03 g/mol |
| Exact Mass | 790.35 |
| IUPAC Name | 10-[3-[3,5-bis(3,5-diphenylphenyl)phenyl]phenyl]-6,7-dihydrobenzo[a]quinolizin-5-ium |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cc(-c4cccc(-c5ccc6c(c5)-c5cccc[n+]5CC6)c4)cc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C61H44N/c1-5-16-43(17-6-1)51-33-52(44-18-7-2-8-19-44)36-56(35-51)58-39-55(49-25-15-24-48(32-49)50-28-27-47-29-31-62-30-14-13-26-61(62)60(47)42-50)40-59(41-58)57-37-53(45-20-9-3-10-21-45)34-54(38-57)46-22-11-4-12-23-46/h1-28,30,32-42H,29,31H2/q+1 |
| InChIKey | FTGZIGIMOACVEQ-UHFFFAOYSA-N |
| XLogP | 15.53 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.03 |
| LogP ≤ 5 | 15.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|