C18H14N+ — CID 143096562
8-phenyl-6H-pyrido[2,1-a]isoindol-5-ium (PubChem CID 143096562) has the molecular formula C18H14N+ and a molecular weight of 244.32 g/mol. Its IUPAC name is 8-phenyl-6H-pyrido[2,1-a]isoindol-5-ium.
| Compound Name | 8-phenyl-6H-pyrido[2,1-a]isoindol-5-ium |
|---|---|
| PubChem CID | 143096562 |
| Molecular Formula | C18H14N+ |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 8-phenyl-6H-pyrido[2,1-a]isoindol-5-ium |
| SMILES | c1ccc(-c2ccc3c(c2)C[n+]2ccccc2-3)cc1 |
| InChI | InChI=1S/C18H14N/c1-2-6-14(7-3-1)15-9-10-17-16(12-15)13-19-11-5-4-8-18(17)19/h1-12H,13H2/q+1 |
| InChIKey | PZQJXIILNTXRAV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|