C19H16N+ — CID 162209498
10-(4-methylphenyl)-6H-pyrido[2,1-a]isoindol-5-ium (PubChem CID 162209498) has the molecular formula C19H16N+ and a molecular weight of 258.34 g/mol. Its IUPAC name is 10-(4-methylphenyl)-6H-pyrido[2,1-a]isoindol-5-ium.
| Compound Name | 10-(4-methylphenyl)-6H-pyrido[2,1-a]isoindol-5-ium |
|---|---|
| PubChem CID | 162209498 |
| Molecular Formula | C19H16N+ |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 10-(4-methylphenyl)-6H-pyrido[2,1-a]isoindol-5-ium |
| SMILES | Cc1ccc(-c2cccc3c2-c2cccc[n+]2C3)cc1 |
| InChI | InChI=1S/C19H16N/c1-14-8-10-15(11-9-14)17-6-4-5-16-13-20-12-3-2-7-18(20)19(16)17/h2-12H,13H2,1H3/q+1 |
| InChIKey | DAZDCJPTBJRARK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|