C23H24 — CID 173306063
1,2-bis(4-methylphenyl)-3-propylbenzene (PubChem CID 173306063) has the molecular formula C23H24 and a molecular weight of 300.45 g/mol. Its IUPAC name is 1,2-bis(4-methylphenyl)-3-propylbenzene.
| Compound Name | 1,2-bis(4-methylphenyl)-3-propylbenzene |
|---|---|
| PubChem CID | 173306063 |
| Molecular Formula | C23H24 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 1,2-bis(4-methylphenyl)-3-propylbenzene |
| SMILES | CCCc1cccc(-c2ccc(C)cc2)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C23H24/c1-4-6-20-7-5-8-22(19-13-9-17(2)10-14-19)23(20)21-15-11-18(3)12-16-21/h5,7-16H,4,6H2,1-3H3 |
| InChIKey | QJBLHODZAGIYQT-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |