C22H20N2O — CID 145180839
5-[2-ethyl-6-(4-methylphenyl)phenyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 145180839) has the molecular formula C22H20N2O and a molecular weight of 328.42 g/mol. Its IUPAC name is 5-[2-ethyl-6-(4-methylphenyl)phenyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[2-ethyl-6-(4-methylphenyl)phenyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 145180839 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 5-[2-ethyl-6-(4-methylphenyl)phenyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | CCc1cccc(-c2ccc(C)cc2)c1-c1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C22H20N2O/c1-3-15-5-4-6-18(16-9-7-14(2)8-10-16)21(15)17-11-12-19-20(13-17)24-22(25)23-19/h4-13H,3H2,1-2H3,(H2,23,24,25) |
| InChIKey | AWJFHOZMQABQBK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |