C10H14N2O — CID 90978639
ethane;5-methyl-1,3-dihydrobenzimidazol-2-one (PubChem CID 90978639) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is ethane;5-methyl-1,3-dihydrobenzimidazol-2-one.
| Compound Name | ethane;5-methyl-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 90978639 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | ethane;5-methyl-1,3-dihydrobenzimidazol-2-one |
| SMILES | CC.Cc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C8H8N2O.C2H6/c1-5-2-3-6-7(4-5)10-8(11)9-6;1-2/h2-4H,1H3,(H2,9,10,11);1-2H3 |
| InChIKey | MCQWQLFFPVWOEZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |