C17H20N2O2 — CID 157345217
1-ethoxy-4-methylbenzene;5-methyl-1,3-dihydrobenzimidazol-2-one (PubChem CID 157345217) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-ethoxy-4-methylbenzene;5-methyl-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 1-ethoxy-4-methylbenzene;5-methyl-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 157345217 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-ethoxy-4-methylbenzene;5-methyl-1,3-dihydrobenzimidazol-2-one |
| SMILES | CCOc1ccc(C)cc1.Cc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C9H12O.C8H8N2O/c1-3-10-9-6-4-8(2)5-7-9;1-5-2-3-6-7(4-5)10-8(11)9-6/h4-7H,3H2,1-2H3;2-4H,1H3,(H2,9,10,11) |
| InChIKey | BGWNBXFHTWKXJM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |