C9H12N2O2 — CID 145445057
6-methyl-1,4-dihydroquinoxaline-2,3-dione;molecular hydrogen (PubChem CID 145445057) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 6-methyl-1,4-dihydroquinoxaline-2,3-dione;molecular hydrogen.
| Compound Name | 6-methyl-1,4-dihydroquinoxaline-2,3-dione;molecular hydrogen |
|---|---|
| PubChem CID | 145445057 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 6-methyl-1,4-dihydroquinoxaline-2,3-dione;molecular hydrogen |
| SMILES | Cc1ccc2[nH]c(=O)c(=O)[nH]c2c1.[H][H].[H][H] |
| InChI | InChI=1S/C9H8N2O2.2H2/c1-5-2-3-6-7(4-5)11-9(13)8(12)10-6;;/h2-4H,1H3,(H,10,12)(H,11,13);2*1H |
| InChIKey | BEHPTTBLZNVLSO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|