About 3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene
3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 143364643) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene.
Analyze 3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene?
The IUPAC name of 3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene (CID 143364643) is 3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene.
What is the SMILES notation for 3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene?
The canonical SMILES for 3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene is Cc1ccc2[nH][nH]c2c1.
What is the InChIKey of 3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene?
The InChIKey is OHYLDPWFCBQUGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c1-5-2-3-6-7(4-5)9-8-6/h2-4,8-9H,1H3.
What are the key properties of 3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene?
3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene has a molecular weight of 120.15 g/mol, XLogP of 1.80, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene is sourced from PubChem (CID 143364643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).