C22H16N2O2 — CID 59728395
3,9-dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (PubChem CID 59728395) has the molecular formula C22H16N2O2 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3,9-dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 3,9-dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 59728395 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3,9-dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
| SMILES | Cc1ccc2c(=O)c3cc4[nH]c5ccc(C)cc5c(=O)c4cc3[nH]c2c1 |
| InChI | InChI=1S/C22H16N2O2/c1-11-4-6-17-14(7-11)22(26)16-10-20-15(9-19(16)23-17)21(25)13-5-3-12(2)8-18(13)24-20/h3-10H,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | ASYKCBFYJPUEQQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|