C19H15N3 — CID 123384681
8-methyl-5,11-dihydroindolo[3,2-b]carbazol-2-amine (PubChem CID 123384681) has the molecular formula C19H15N3 and a molecular weight of 285.35 g/mol. Its IUPAC name is 8-methyl-5,11-dihydroindolo[3,2-b]carbazol-2-amine.
| Compound Name | 8-methyl-5,11-dihydroindolo[3,2-b]carbazol-2-amine |
|---|---|
| PubChem CID | 123384681 |
| Molecular Formula | C19H15N3 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 8-methyl-5,11-dihydroindolo[3,2-b]carbazol-2-amine |
| SMILES | Cc1ccc2[nH]c3cc4c(cc3c2c1)[nH]c1ccc(N)cc14 |
| InChI | InChI=1S/C19H15N3/c1-10-2-4-16-12(6-10)14-8-19-15(9-18(14)21-16)13-7-11(20)3-5-17(13)22-19/h2-9,21-22H,20H2,1H3 |
| InChIKey | SMXMUXCKQUFLFI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 57.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|