C21H13ClN2O2 — CID 59775439
2-chloro-9-methyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (PubChem CID 59775439) has the molecular formula C21H13ClN2O2 and a molecular weight of 360.80 g/mol. Its IUPAC name is 2-chloro-9-methyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 2-chloro-9-methyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 59775439 |
| Molecular Formula | C21H13ClN2O2 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2-chloro-9-methyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
| SMILES | Cc1ccc2[nH]c3cc4c(=O)c5cc(Cl)ccc5[nH]c4cc3c(=O)c2c1 |
| InChI | InChI=1S/C21H13ClN2O2/c1-10-2-4-16-12(6-10)20(25)14-8-19-15(9-18(14)23-16)21(26)13-7-11(22)3-5-17(13)24-19/h2-9H,1H3,(H,23,25)(H,24,26) |
| InChIKey | NXCQWKLJSUTFNP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|