C20H10Cl2N2S2 — CID 14178328
2,9-dichloro-5,12-dihydroquinolino[2,3-b]acridine-7,14-dithione (PubChem CID 14178328) has the molecular formula C20H10Cl2N2S2 and a molecular weight of 413.35 g/mol. Its IUPAC name is 2,9-dichloro-5,12-dihydroquinolino[2,3-b]acridine-7,14-dithione.
| Compound Name | 2,9-dichloro-5,12-dihydroquinolino[2,3-b]acridine-7,14-dithione |
|---|---|
| PubChem CID | 14178328 |
| Molecular Formula | C20H10Cl2N2S2 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | 2,9-dichloro-5,12-dihydroquinolino[2,3-b]acridine-7,14-dithione |
| SMILES | S=c1c2cc(Cl)ccc2[nH]c2cc3c(=S)c4cc(Cl)ccc4[nH]c3cc12 |
| InChI | InChI=1S/C20H10Cl2N2S2/c21-9-1-3-15-11(5-9)19(25)13-8-18-14(7-17(13)23-15)20(26)12-6-10(22)2-4-16(12)24-18/h1-8H,(H,23,25)(H,24,26) |
| InChIKey | UGQUOJMAMORWCD-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|