C12H13Cl2N3 — CID 131882609
9H-carbazole-3,6-diamine;dihydrochloride (PubChem CID 131882609) has the molecular formula C12H13Cl2N3 and a molecular weight of 270.16 g/mol. Its IUPAC name is 9H-carbazole-3,6-diamine;dihydrochloride.
| Compound Name | 9H-carbazole-3,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 131882609 |
| Molecular Formula | C12H13Cl2N3 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 9H-carbazole-3,6-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc2[nH]c3ccc(N)cc3c2c1 |
| InChI | InChI=1S/C12H11N3.2ClH/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11;;/h1-6,15H,13-14H2;2*1H |
| InChIKey | KPOUHNKGJFCGLE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|