C28H25N3 — CID 161187316
anthracene;1-ethyl-9H-carbazole-3,6-diamine (PubChem CID 161187316) has the molecular formula C28H25N3 and a molecular weight of 403.53 g/mol. Its IUPAC name is anthracene;1-ethyl-9H-carbazole-3,6-diamine.
| Compound Name | anthracene;1-ethyl-9H-carbazole-3,6-diamine |
|---|---|
| PubChem CID | 161187316 |
| Molecular Formula | C28H25N3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | anthracene;1-ethyl-9H-carbazole-3,6-diamine |
| SMILES | CCc1cc(N)cc2c1[nH]c1ccc(N)cc12.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H15N3.C14H10/c1-2-8-5-10(16)7-12-11-6-9(15)3-4-13(11)17-14(8)12;1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h3-7,17H,2,15-16H2,1H3;1-10H |
| InChIKey | UTGFUGZUUGEQBA-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|