About 9-amino-1,4-dihydrobenzo[f]quinoxaline-2,3-dione;hydrochloride
9-amino-1,4-dihydrobenzo[f]quinoxaline-2,3-dione;hydrochloride (PubChem CID 67674687) has the molecular formula C12H10ClN3O2
and a molecular weight of 263.68 g/mol. Its IUPAC name is 9-amino-1,4-dihydrobenzo[f]quinoxaline-2,3-dione;hydrochloride.
Molecular Properties
| Compound Name | 9-amino-1,4-dihydrobenzo[f]quinoxaline-2,3-dione;hydrochloride |
| PubChem CID | 67674687 |
| Molecular Formula | C12H10ClN3O2 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 9-amino-1,4-dihydrobenzo[f]quinoxaline-2,3-dione;hydrochloride |
| SMILES | Cl.Nc1ccc2ccc3[nH]c(=O)c(=O)[nH]c3c2c1 |
| InChI | InChI=1S/C12H9N3O2.ClH/c13-7-3-1-6-2-4-9-10(8(6)5-7)15-12(17)11(16)14-9;/h1-5H,13H2,(H,14,16)(H,15,17);1H |
| InChIKey | ZFBNOINGCBWULK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-amino-1,4-dihydrobenzo[f]quinoxaline-2,3-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-1,4-dihydrobenzo[f]quinoxaline-2,3-dione;hydrochloride?
The IUPAC name of 9-amino-1,4-dihydrobenzo[f]quinoxaline-2,3-dione;hydrochloride (CID 67674687) is 9-amino-1,4-dihydrobenzo[f]quinoxaline-2,3-dione;hydrochloride.
What is the SMILES notation for 9-amino-1,4-dihydrobenzo[f]quinoxaline-2,3-dione;hydrochloride?
The canonical SMILES for 9-amino-1,4-dihydrobenzo[f]quinoxaline-2,3-dione;hydrochloride is Cl.Nc1ccc2ccc3[nH]c(=O)c(=O)[nH]c3c2c1.
What is the InChIKey of 9-amino-1,4-dihydrobenzo[f]quinoxaline-2,3-dione;hydrochloride?
The InChIKey is ZFBNOINGCBWULK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O2.ClH/c13-7-3-1-6-2-4-9-10(8(6)5-7)15-12(17)11(16)14-9;/h1-5H,13H2,(H,14,16)(H,15,17);1H.
What are the key properties of 9-amino-1,4-dihydrobenzo[f]quinoxaline-2,3-dione;hydrochloride?
9-amino-1,4-dihydrobenzo[f]quinoxaline-2,3-dione;hydrochloride has a molecular weight of 263.68 g/mol, XLogP of 1.37, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-1,4-dihydrobenzo[f]quinoxaline-2,3-dione;hydrochloride is sourced from PubChem (CID 67674687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).