C21H19N3 — CID 154027213
1-ethyl-6-phenylphenanthridine-3,8-diamine (PubChem CID 154027213) has the molecular formula C21H19N3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-ethyl-6-phenylphenanthridine-3,8-diamine.
| Compound Name | 1-ethyl-6-phenylphenanthridine-3,8-diamine |
|---|---|
| PubChem CID | 154027213 |
| Molecular Formula | C21H19N3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-ethyl-6-phenylphenanthridine-3,8-diamine |
| SMILES | CCc1cc(N)cc2nc(-c3ccccc3)c3cc(N)ccc3c12 |
| InChI | InChI=1S/C21H19N3/c1-2-13-10-16(23)12-19-20(13)17-9-8-15(22)11-18(17)21(24-19)14-6-4-3-5-7-14/h3-12H,2,22-23H2,1H3 |
| InChIKey | CPZBBKHLRXICQX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|