About 3-N,8-N-dimethyl-6-phenylphenanthridine-3,8-diamine
3-N,8-N-dimethyl-6-phenylphenanthridine-3,8-diamine (PubChem CID 21124518) has the molecular formula C21H19N3
and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-N,8-N-dimethyl-6-phenylphenanthridine-3,8-diamine.
Molecular Properties
| Compound Name | 3-N,8-N-dimethyl-6-phenylphenanthridine-3,8-diamine |
| PubChem CID | 21124518 |
| Molecular Formula | C21H19N3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 3-N,8-N-dimethyl-6-phenylphenanthridine-3,8-diamine |
| SMILES | CNc1ccc2c(c1)nc(-c1ccccc1)c1cc(NC)ccc12 |
| InChI | InChI=1S/C21H19N3/c1-22-15-8-10-17-18-11-9-16(23-2)13-20(18)24-21(19(17)12-15)14-6-4-3-5-7-14/h3-13,22-23H,1-2H3 |
| InChIKey | LXBJOCXCJSYXNR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-N,8-N-dimethyl-6-phenylphenanthridine-3,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,8-N-dimethyl-6-phenylphenanthridine-3,8-diamine?
The IUPAC name of 3-N,8-N-dimethyl-6-phenylphenanthridine-3,8-diamine (CID 21124518) is 3-N,8-N-dimethyl-6-phenylphenanthridine-3,8-diamine.
What is the SMILES notation for 3-N,8-N-dimethyl-6-phenylphenanthridine-3,8-diamine?
The canonical SMILES for 3-N,8-N-dimethyl-6-phenylphenanthridine-3,8-diamine is CNc1ccc2c(c1)nc(-c1ccccc1)c1cc(NC)ccc12.
What is the InChIKey of 3-N,8-N-dimethyl-6-phenylphenanthridine-3,8-diamine?
The InChIKey is LXBJOCXCJSYXNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3/c1-22-15-8-10-17-18-11-9-16(23-2)13-20(18)24-21(19(17)12-15)14-6-4-3-5-7-14/h3-13,22-23H,1-2H3.
What are the key properties of 3-N,8-N-dimethyl-6-phenylphenanthridine-3,8-diamine?
3-N,8-N-dimethyl-6-phenylphenanthridine-3,8-diamine has a molecular weight of 313.40 g/mol, XLogP of 5.14, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,8-N-dimethyl-6-phenylphenanthridine-3,8-diamine is sourced from PubChem (CID 21124518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).