C23H19N7S4 — CID 24840997
1-carbamothioyl-3-[3-(carbamothioylcarbamothioylamino)-6-phenylphenanthridin-8-yl]thiourea (PubChem CID 24840997) has the molecular formula C23H19N7S4 and a molecular weight of 521.72 g/mol. Its IUPAC name is 1-carbamothioyl-3-[3-(carbamothioylcarbamothioylamino)-6-phenylphenanthridin-8-yl]thiourea.
| Compound Name | 1-carbamothioyl-3-[3-(carbamothioylcarbamothioylamino)-6-phenylphenanthridin-8-yl]thiourea |
|---|---|
| PubChem CID | 24840997 |
| Molecular Formula | C23H19N7S4 |
| Molecular Weight | 521.72 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | 1-carbamothioyl-3-[3-(carbamothioylcarbamothioylamino)-6-phenylphenanthridin-8-yl]thiourea |
| SMILES | NC(=S)NC(=S)Nc1ccc2c(c1)nc(-c1ccccc1)c1cc(NC(=S)NC(N)=S)ccc12 |
| InChI | InChI=1S/C23H19N7S4/c24-20(31)29-22(33)26-13-6-8-15-16-9-7-14(27-23(34)30-21(25)32)11-18(16)28-19(17(15)10-13)12-4-2-1-3-5-12/h1-11H,(H4,24,26,29,31,33)(H4,25,27,30,32,34) |
| InChIKey | GSUGVMFPLCNHMD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.72 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|