C17H13N3O2S — CID 169357218
2-[3-(carbamothioylamino)phenyl]quinoline-4-carboxylic acid (PubChem CID 169357218) has the molecular formula C17H13N3O2S and a molecular weight of 323.38 g/mol. Its IUPAC name is 2-[3-(carbamothioylamino)phenyl]quinoline-4-carboxylic acid.
| Compound Name | 2-[3-(carbamothioylamino)phenyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 169357218 |
| Molecular Formula | C17H13N3O2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-[3-(carbamothioylamino)phenyl]quinoline-4-carboxylic acid |
| SMILES | NC(=S)Nc1cccc(-c2cc(C(=O)O)c3ccccc3n2)c1 |
| InChI | InChI=1S/C17H13N3O2S/c18-17(23)19-11-5-3-4-10(8-11)15-9-13(16(21)22)12-6-1-2-7-14(12)20-15/h1-9H,(H,21,22)(H3,18,19,23) |
| InChIKey | HXWIGYARYUFESN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|