C21H16ClN5S — CID 100750673
1-[(7-chloro-4-phenylquinazolin-2-yl)amino]-3-phenylthiourea (PubChem CID 100750673) has the molecular formula C21H16ClN5S and a molecular weight of 405.91 g/mol. Its IUPAC name is 1-[(7-chloro-4-phenylquinazolin-2-yl)amino]-3-phenylthiourea.
| Compound Name | 1-[(7-chloro-4-phenylquinazolin-2-yl)amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 100750673 |
| Molecular Formula | C21H16ClN5S |
| Molecular Weight | 405.91 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 1-[(7-chloro-4-phenylquinazolin-2-yl)amino]-3-phenylthiourea |
| SMILES | S=C(NNc1nc(-c2ccccc2)c2ccc(Cl)cc2n1)Nc1ccccc1 |
| InChI | InChI=1S/C21H16ClN5S/c22-15-11-12-17-18(13-15)24-20(25-19(17)14-7-3-1-4-8-14)26-27-21(28)23-16-9-5-2-6-10-16/h1-13H,(H2,23,27,28)(H,24,25,26) |
| InChIKey | VHPIYMNCIRCWKO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.91 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_G(5)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|