C18H24N8S — CID 124555504
1-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-3-phenylthiourea (PubChem CID 124555504) has the molecular formula C18H24N8S and a molecular weight of 384.51 g/mol. Its IUPAC name is 1-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-3-phenylthiourea.
| Compound Name | 1-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 124555504 |
| Molecular Formula | C18H24N8S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-[(4,6-dipyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-3-phenylthiourea |
| SMILES | S=C(NNc1nc(N2CCCC2)nc(N2CCCC2)n1)Nc1ccccc1 |
| InChI | InChI=1S/C18H24N8S/c27-18(19-14-8-2-1-3-9-14)24-23-15-20-16(25-10-4-5-11-25)22-17(21-15)26-12-6-7-13-26/h1-3,8-9H,4-7,10-13H2,(H2,19,24,27)(H,20,21,22,23) |
| InChIKey | TXFOWIPQVJNYQO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_urea_G(5)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|