C18H23ClN8O2S — CID 18580125
1-(4-chlorophenyl)-3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]thiourea (PubChem CID 18580125) has the molecular formula C18H23ClN8O2S and a molecular weight of 450.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]thiourea |
|---|---|
| PubChem CID | 18580125 |
| Molecular Formula | C18H23ClN8O2S |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]thiourea |
| SMILES | S=C(NNc1nc(N2CCOCC2)nc(N2CCOCC2)n1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23ClN8O2S/c19-13-1-3-14(4-2-13)20-18(30)25-24-15-21-16(26-5-9-28-10-6-26)23-17(22-15)27-7-11-29-12-8-27/h1-4H,5-12H2,(H2,20,25,30)(H,21,22,23,24) |
| InChIKey | WVEJMPLCTSRJIF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_urea_G(5)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|