C19H26N8O2S — CID 16823466
1-benzyl-3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]thiourea (PubChem CID 16823466) has the molecular formula C19H26N8O2S and a molecular weight of 430.54 g/mol. Its IUPAC name is 1-benzyl-3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]thiourea.
| Compound Name | 1-benzyl-3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]thiourea |
|---|---|
| PubChem CID | 16823466 |
| Molecular Formula | C19H26N8O2S |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 1-benzyl-3-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]thiourea |
| SMILES | S=C(NCc1ccccc1)NNc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H26N8O2S/c30-19(20-14-15-4-2-1-3-5-15)25-24-16-21-17(26-6-10-28-11-7-26)23-18(22-16)27-8-12-29-13-9-27/h1-5H,6-14H2,(H2,20,25,30)(H,21,22,23,24) |
| InChIKey | UJKQLMXVMIIVNV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|