C21H35N6O2PS2 — CID 4227182
1-benzyl-3-[[tert-butyl(dimorpholin-4-yl)-λ5-phosphanylidene]carbamothioylamino]thiourea (PubChem CID 4227182) has the molecular formula C21H35N6O2PS2 and a molecular weight of 498.66 g/mol. Its IUPAC name is 1-benzyl-3-[[tert-butyl(dimorpholin-4-yl)-λ5-phosphanylidene]carbamothioylamino]thiourea.
| Compound Name | 1-benzyl-3-[[tert-butyl(dimorpholin-4-yl)-λ5-phosphanylidene]carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 4227182 |
| Molecular Formula | C21H35N6O2PS2 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 1-benzyl-3-[[tert-butyl(dimorpholin-4-yl)-λ5-phosphanylidene]carbamothioylamino]thiourea |
| SMILES | CC(C)(C)P(=NC(=S)NNC(=S)NCc1ccccc1)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C21H35N6O2PS2/c1-21(2,3)30(26-9-13-28-14-10-26,27-11-15-29-16-12-27)25-20(32)24-23-19(31)22-17-18-7-5-4-6-8-18/h4-8H,9-17H2,1-3H3,(H,24,32)(H2,22,23,31) |
| InChIKey | JGYCNUCGGPKTQI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|