C21H34N5O3PS — CID 4599435
1-[tert-butyl(dimorpholin-4-yl)-λ5-phosphanylidene]-3-[(3-methoxyphenyl)methylideneamino]thiourea (PubChem CID 4599435) has the molecular formula C21H34N5O3PS and a molecular weight of 467.58 g/mol. Its IUPAC name is 1-[tert-butyl(dimorpholin-4-yl)-λ5-phosphanylidene]-3-[(3-methoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-[tert-butyl(dimorpholin-4-yl)-λ5-phosphanylidene]-3-[(3-methoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 4599435 |
| Molecular Formula | C21H34N5O3PS |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 1-[tert-butyl(dimorpholin-4-yl)-λ5-phosphanylidene]-3-[(3-methoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1cccc(C=NNC(=S)N=P(N2CCOCC2)(N2CCOCC2)C(C)(C)C)c1 |
| InChI | InChI=1S/C21H34N5O3PS/c1-21(2,3)30(25-8-12-28-13-9-25,26-10-14-29-15-11-26)24-20(31)23-22-17-18-6-5-7-19(16-18)27-4/h5-7,16-17H,8-15H2,1-4H3,(H,23,31) |
| InChIKey | BJFSZLYNXNARQB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|