C22H30N3O2PS — CID 23820411
1-(tert-butyl-morpholin-4-yl-phenyl-λ5-phosphanylidene)-3-(4-methoxyphenyl)thiourea (PubChem CID 23820411) has the molecular formula C22H30N3O2PS and a molecular weight of 431.54 g/mol. Its IUPAC name is 1-(tert-butyl-morpholin-4-yl-phenyl-λ5-phosphanylidene)-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-(tert-butyl-morpholin-4-yl-phenyl-λ5-phosphanylidene)-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 23820411 |
| Molecular Formula | C22H30N3O2PS |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 1-(tert-butyl-morpholin-4-yl-phenyl-λ5-phosphanylidene)-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)N=P(c2ccccc2)(N2CCOCC2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H30N3O2PS/c1-22(2,3)28(20-8-6-5-7-9-20,25-14-16-27-17-15-25)24-21(29)23-18-10-12-19(26-4)13-11-18/h5-13H,14-17H2,1-4H3,(H,23,29) |
| InChIKey | XLIXGBQNMUFQPK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|