C22H30N3OPS — CID 23986718
1-(tert-butyl-morpholin-4-yl-phenyl-λ5-phosphanylidene)-3-(2-methylphenyl)thiourea (PubChem CID 23986718) has the molecular formula C22H30N3OPS and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-(tert-butyl-morpholin-4-yl-phenyl-λ5-phosphanylidene)-3-(2-methylphenyl)thiourea.
| Compound Name | 1-(tert-butyl-morpholin-4-yl-phenyl-λ5-phosphanylidene)-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 23986718 |
| Molecular Formula | C22H30N3OPS |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 1-(tert-butyl-morpholin-4-yl-phenyl-λ5-phosphanylidene)-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)N=P(c1ccccc1)(N1CCOCC1)C(C)(C)C |
| InChI | InChI=1S/C22H30N3OPS/c1-18-10-8-9-13-20(18)23-21(28)24-27(22(2,3)4,19-11-6-5-7-12-19)25-14-16-26-17-15-25/h5-13H,14-17H2,1-4H3,(H,23,28) |
| InChIKey | WADDKSRGHSNSSH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|