C21H26Cl2N3OPS — CID 23961809
1-(tert-butyl-morpholin-4-yl-phenyl-λ5-phosphanylidene)-3-(2,4-dichlorophenyl)thiourea (PubChem CID 23961809) has the molecular formula C21H26Cl2N3OPS and a molecular weight of 470.41 g/mol. Its IUPAC name is 1-(tert-butyl-morpholin-4-yl-phenyl-λ5-phosphanylidene)-3-(2,4-dichlorophenyl)thiourea.
| Compound Name | 1-(tert-butyl-morpholin-4-yl-phenyl-λ5-phosphanylidene)-3-(2,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 23961809 |
| Molecular Formula | C21H26Cl2N3OPS |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 1-(tert-butyl-morpholin-4-yl-phenyl-λ5-phosphanylidene)-3-(2,4-dichlorophenyl)thiourea |
| SMILES | CC(C)(C)P(=NC(=S)Nc1ccc(Cl)cc1Cl)(c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C21H26Cl2N3OPS/c1-21(2,3)28(17-7-5-4-6-8-17,26-11-13-27-14-12-26)25-20(29)24-19-10-9-16(22)15-18(19)23/h4-10,15H,11-14H2,1-3H3,(H,24,29) |
| InChIKey | MYHFNLQGEDOGCH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|