C16H16Cl2N6O2S — CID 170856383
(3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-(6-morpholin-4-ylpyrazin-2-yl)methylidene]thiourea (PubChem CID 170856383) has the molecular formula C16H16Cl2N6O2S and a molecular weight of 427.32 g/mol. Its IUPAC name is (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-(6-morpholin-4-ylpyrazin-2-yl)methylidene]thiourea.
| Compound Name | (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-(6-morpholin-4-ylpyrazin-2-yl)methylidene]thiourea |
|---|---|
| PubChem CID | 170856383 |
| Molecular Formula | C16H16Cl2N6O2S |
| Molecular Weight | 427.32 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-(6-morpholin-4-ylpyrazin-2-yl)methylidene]thiourea |
| SMILES | ON/C(=N\C(=S)Nc1ccc(Cl)cc1Cl)c1cncc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H16Cl2N6O2S/c17-10-1-2-12(11(18)7-10)21-16(27)22-15(23-25)13-8-19-9-14(20-13)24-3-5-26-6-4-24/h1-2,7-9,25H,3-6H2,(H2,21,22,23,27) |
| InChIKey | HEROMOKIARQAAO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|