C13H15Cl2N3O2 — CID 17388030
(1E)-1-[(2,4-dichlorophenyl)hydrazinylidene]-1-morpholin-4-ylpropan-2-one (PubChem CID 17388030) has the molecular formula C13H15Cl2N3O2 and a molecular weight of 316.19 g/mol. Its IUPAC name is (1E)-1-[(2,4-dichlorophenyl)hydrazinylidene]-1-morpholin-4-ylpropan-2-one.
| Compound Name | (1E)-1-[(2,4-dichlorophenyl)hydrazinylidene]-1-morpholin-4-ylpropan-2-one |
|---|---|
| PubChem CID | 17388030 |
| Molecular Formula | C13H15Cl2N3O2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | (1E)-1-[(2,4-dichlorophenyl)hydrazinylidene]-1-morpholin-4-ylpropan-2-one |
| SMILES | CC(=O)/C(=N\Nc1ccc(Cl)cc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C13H15Cl2N3O2/c1-9(19)13(18-4-6-20-7-5-18)17-16-12-3-2-10(14)8-11(12)15/h2-3,8,16H,4-7H2,1H3/b17-13+ |
| InChIKey | CHKPEWICZLWGGS-GHRIWEEISA-N |
| XLogP | 2.64 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|