C14H18ClN3O2 — CID 6537731
(1Z)-1-[(3-chloro-2-methylphenyl)hydrazinylidene]-1-morpholin-4-ylpropan-2-one (PubChem CID 6537731) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is (1Z)-1-[(3-chloro-2-methylphenyl)hydrazinylidene]-1-morpholin-4-ylpropan-2-one.
| Compound Name | (1Z)-1-[(3-chloro-2-methylphenyl)hydrazinylidene]-1-morpholin-4-ylpropan-2-one |
|---|---|
| PubChem CID | 6537731 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (1Z)-1-[(3-chloro-2-methylphenyl)hydrazinylidene]-1-morpholin-4-ylpropan-2-one |
| SMILES | CC(=O)/C(=N/Nc1cccc(Cl)c1C)N1CCOCC1 |
| InChI | InChI=1S/C14H18ClN3O2/c1-10-12(15)4-3-5-13(10)16-17-14(11(2)19)18-6-8-20-9-7-18/h3-5,16H,6-9H2,1-2H3/b17-14- |
| InChIKey | BZGVYZAYDLSGML-VKAVYKQESA-N |
| XLogP | 2.30 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|