C10H15ClN4 — CID 10036665
2-(3-chloro-2-methylanilino)-1,1-dimethylguanidine (PubChem CID 10036665) has the molecular formula C10H15ClN4 and a molecular weight of 226.71 g/mol. Its IUPAC name is 2-(3-chloro-2-methylanilino)-1,1-dimethylguanidine.
| Compound Name | 2-(3-chloro-2-methylanilino)-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 10036665 |
| Molecular Formula | C10H15ClN4 |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-(3-chloro-2-methylanilino)-1,1-dimethylguanidine |
| SMILES | Cc1c(Cl)cccc1N/N=C(\N)N(C)C |
| InChI | InChI=1S/C10H15ClN4/c1-7-8(11)5-4-6-9(7)13-14-10(12)15(2)3/h4-6,13H,1-3H3,(H2,12,14) |
| InChIKey | PTEZIGIEEFRWOI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|