C21H31ClN4O2S — CID 4062174
1-(1-acetylpiperidin-4-yl)-3-(3-chloro-2-methylphenyl)-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 4062174) has the molecular formula C21H31ClN4O2S and a molecular weight of 439.03 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-(3-chloro-2-methylphenyl)-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-(3-chloro-2-methylphenyl)-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 4062174 |
| Molecular Formula | C21H31ClN4O2S |
| Molecular Weight | 439.03 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-(3-chloro-2-methylphenyl)-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CC(=O)N1CCC(N(CCN2CCOCC2)C(=S)Nc2cccc(Cl)c2C)CC1 |
| InChI | InChI=1S/C21H31ClN4O2S/c1-16-19(22)4-3-5-20(16)23-21(29)26(11-10-24-12-14-28-15-13-24)18-6-8-25(9-7-18)17(2)27/h3-5,18H,6-15H2,1-2H3,(H,23,29) |
| InChIKey | MKGKYALHQNGLCL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.03 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|