C25H33ClN4O2 — CID 50820069
4-tert-butyl-N-[N-(3-chloro-2-methylphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]benzamide (PubChem CID 50820069) has the molecular formula C25H33ClN4O2 and a molecular weight of 457.02 g/mol. Its IUPAC name is 4-tert-butyl-N-[N-(3-chloro-2-methylphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]benzamide.
| Compound Name | 4-tert-butyl-N-[N-(3-chloro-2-methylphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 50820069 |
| Molecular Formula | C25H33ClN4O2 |
| Molecular Weight | 457.02 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 4-tert-butyl-N-[N-(3-chloro-2-methylphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]benzamide |
| SMILES | Cc1c(Cl)cccc1N/C(=N/CCN1CCOCC1)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H33ClN4O2/c1-18-21(26)6-5-7-22(18)28-24(27-12-13-30-14-16-32-17-15-30)29-23(31)19-8-10-20(11-9-19)25(2,3)4/h5-11H,12-17H2,1-4H3,(H2,27,28,29,31) |
| InChIKey | OHKNWJFNOMOWKE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.02 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|