C20H32N5O5P — CID 3102214
N'-dimorpholin-4-ylphosphoryl-N-(4-methoxyphenyl)morpholine-4-carboximidamide (PubChem CID 3102214) has the molecular formula C20H32N5O5P and a molecular weight of 453.48 g/mol. Its IUPAC name is N'-dimorpholin-4-ylphosphoryl-N-(4-methoxyphenyl)morpholine-4-carboximidamide.
| Compound Name | N'-dimorpholin-4-ylphosphoryl-N-(4-methoxyphenyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 3102214 |
| Molecular Formula | C20H32N5O5P |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N'-dimorpholin-4-ylphosphoryl-N-(4-methoxyphenyl)morpholine-4-carboximidamide |
| SMILES | COc1ccc(NC(=NP(=O)(N2CCOCC2)N2CCOCC2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H32N5O5P/c1-27-19-4-2-18(3-5-19)21-20(23-6-12-28-13-7-23)22-31(26,24-8-14-29-15-9-24)25-10-16-30-17-11-25/h2-5H,6-17H2,1H3,(H,21,22,26) |
| InChIKey | WUFHJSSWHPCPIW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|