C18H22FN7O2 — CID 50874129
4-fluoro-N'-(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)benzohydrazide (PubChem CID 50874129) has the molecular formula C18H22FN7O2 and a molecular weight of 387.42 g/mol. Its IUPAC name is 4-fluoro-N'-(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)benzohydrazide.
| Compound Name | 4-fluoro-N'-(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)benzohydrazide |
|---|---|
| PubChem CID | 50874129 |
| Molecular Formula | C18H22FN7O2 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 4-fluoro-N'-(4-morpholin-4-yl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)benzohydrazide |
| SMILES | O=C(NNc1nc(N2CCCC2)nc(N2CCOCC2)n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FN7O2/c19-14-5-3-13(4-6-14)15(27)23-24-16-20-17(25-7-1-2-8-25)22-18(21-16)26-9-11-28-12-10-26/h3-6H,1-2,7-12H2,(H,23,27)(H,20,21,22,24) |
| InChIKey | CEOXTUSHFGDVRV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|