C19H19N3O2S — CID 17099835
2,2-dimethyl-N-[(2-phenyl-1,3-benzoxazol-5-yl)carbamothioyl]propanamide (PubChem CID 17099835) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(2-phenyl-1,3-benzoxazol-5-yl)carbamothioyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(2-phenyl-1,3-benzoxazol-5-yl)carbamothioyl]propanamide |
|---|---|
| PubChem CID | 17099835 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 2,2-dimethyl-N-[(2-phenyl-1,3-benzoxazol-5-yl)carbamothioyl]propanamide |
| SMILES | CC(C)(C)C(=O)NC(=S)Nc1ccc2oc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C19H19N3O2S/c1-19(2,3)17(23)22-18(25)20-13-9-10-15-14(11-13)21-16(24-15)12-7-5-4-6-8-12/h4-11H,1-3H3,(H2,20,22,23,25) |
| InChIKey | IWXVGHVVVUOXMB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|