About 5-ethylquinolin-2-amine
5-ethylquinolin-2-amine (PubChem CID 59551845) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 5-ethylquinolin-2-amine.
Molecular Properties
| Compound Name | 5-ethylquinolin-2-amine |
| PubChem CID | 59551845 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 5-ethylquinolin-2-amine |
| SMILES | CCc1cccc2nc(N)ccc12 |
| InChI | InChI=1S/C11H12N2/c1-2-8-4-3-5-10-9(8)6-7-11(12)13-10/h3-7H,2H2,1H3,(H2,12,13) |
| InChIKey | GYNCKCHWKOWSDG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethylquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylquinolin-2-amine?
The IUPAC name of 5-ethylquinolin-2-amine (CID 59551845) is 5-ethylquinolin-2-amine.
What is the SMILES notation for 5-ethylquinolin-2-amine?
The canonical SMILES for 5-ethylquinolin-2-amine is CCc1cccc2nc(N)ccc12.
What is the InChIKey of 5-ethylquinolin-2-amine?
The InChIKey is GYNCKCHWKOWSDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-2-8-4-3-5-10-9(8)6-7-11(12)13-10/h3-7H,2H2,1H3,(H2,12,13).
What are the key properties of 5-ethylquinolin-2-amine?
5-ethylquinolin-2-amine has a molecular weight of 172.23 g/mol, XLogP of 2.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylquinolin-2-amine is sourced from PubChem (CID 59551845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).