C17H18N2O3 — CID 157209438
(2S)-2-aminopropanoic acid;2-methyl-10H-acridin-9-one (PubChem CID 157209438) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2S)-2-aminopropanoic acid;2-methyl-10H-acridin-9-one.
| Compound Name | (2S)-2-aminopropanoic acid;2-methyl-10H-acridin-9-one |
|---|---|
| PubChem CID | 157209438 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (2S)-2-aminopropanoic acid;2-methyl-10H-acridin-9-one |
| SMILES | C[C@H](N)C(=O)O.Cc1ccc2[nH]c3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C14H11NO.C3H7NO2/c1-9-6-7-13-11(8-9)14(16)10-4-2-3-5-12(10)15-13;1-2(4)3(5)6/h2-8H,1H3,(H,15,16);2H,4H2,1H3,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | ARSLOUMQUWWJNO-WNQIDUERSA-N |
| XLogP | 2.41 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|