About 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen
3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen (PubChem CID 144928810) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen.
Molecular Properties
| Compound Name | 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen |
| PubChem CID | 144928810 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen |
| SMILES | Cc1ccc2[nH]c(=O)n(C)c2c1.[H][H] |
| InChI | InChI=1S/C9H10N2O.H2/c1-6-3-4-7-8(5-6)11(2)9(12)10-7;/h3-5H,1-2H3,(H,10,12);1H |
| InChIKey | LPEVESNASKMVRO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen?
The IUPAC name of 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen (CID 144928810) is 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen.
What is the SMILES notation for 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen?
The canonical SMILES for 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen is Cc1ccc2[nH]c(=O)n(C)c2c1.[H][H].
What is the InChIKey of 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen?
The InChIKey is LPEVESNASKMVRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O.H2/c1-6-3-4-7-8(5-6)11(2)9(12)10-7;/h3-5H,1-2H3,(H,10,12);1H.
What are the key properties of 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen?
3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen has a molecular weight of 164.21 g/mol, XLogP of 1.42, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen is sourced from PubChem (CID 144928810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).