C9H12N2O — CID 144928810
3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen (PubChem CID 144928810) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen.
| Compound Name | 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen |
|---|---|
| PubChem CID | 144928810 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 3,5-dimethyl-1H-benzimidazol-2-one;molecular hydrogen |
| SMILES | Cc1ccc2[nH]c(=O)n(C)c2c1.[H][H] |
| InChI | InChI=1S/C9H10N2O.H2/c1-6-3-4-7-8(5-6)11(2)9(12)10-7;/h3-5H,1-2H3,(H,10,12);1H |
| InChIKey | LPEVESNASKMVRO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |